| Name | Dimethylphenol |
| Synonyms | Xylenol Xylenols ai3-00056 Dimethylphenol dimethyl-pheno xylenol, all isomers dimethylhydroxybenzene Xylenol, isomer mixture Xylenol (mixed isomers) |
| CAS | 1300-71-6 |
| EINECS | 215-089-3 |
| InChI | InChI=1/C8H10O/c1-6-4-3-5-7(2)8(6)9/h3-5,9H,1-2H3 |
| Molecular Formula | C8H10O |
| Molar Mass | 122.16 |
| Density | 0.9863 (estimate) |
| Melting Point | 42.65°C (estimate) |
| Boling Point | 209.6°C (estimate) |
| Flash Point | 78.3°C |
| Water Solubility | 11g/L at 25℃ |
| Vapor Presure | 71.3Pa at 20℃ |
| Odor | Sweet tarry. |
| Refractive Index | 1.5321 (estimate) |
| Physical and Chemical Properties | White crystals. |
| Use | Used as a disinfectant, plasticizer, pesticide raw materials, for the extraction of 3, 5-xylenol, 3, 4-xylenol, etc |
| UN IDs | 2261 |
| Hazard Class | 6.1(a) |
| Packing Group | II |
| Toxicity | LDLo oral in man: 5gm/kg |
| LogP | 3 at 20℃ |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | used as a raw material for disinfectants, plasticizers, pesticides, used to extract 3, 5-xylenol, 3, 4-xylenol |
| production method | 1. Tobacco: FC,40; Synthesis: can be obtained by crude through fractionation. |
| category | corrosive article |
| toxicity grade | poisoning |
| Acute toxicity | oral-human LD50: 5000 mg/kg |
| explosive hazard characteristics | corrosive to skin and cornea |
| flammability hazard characteristics | flammable in case of open flame and high heat; Combustion-induced smoke |
| storage and transportation characteristics | The warehouse is ventilated and dried at low temperature; It is stored separately from the oxidant. |
| fire extinguishing agent | Sand, foam, carbon dioxide, water mist |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |