| Name | diethoxymethyl acetate |
| Synonyms | Nsc158267 Diethoxymethyleacetate DIETHOXYMETHYL ACETATE diethoxymethyl acetate diethoxy-methanoacetate Diethyloxymethyl acetate METHYL 2,2-DIETHOXYACETATE Methyl 2,2-Diethoxyacetate methanol, diethoxy-, acetate Acetic acid diethoxymethyl ester ACETIC ACID DIETHOXYMETHYL ESTER |
| CAS | 14036-06-7 |
| EINECS | 237-873-4 |
| InChI | InChI=1/C7H14O4/c1-4-9-7(10-5-2)11-6(3)8/h7H,4-5H2,1-3H3 |
| Molecular Formula | C7H14O4 |
| Molar Mass | 162.18 |
| Density | 0.993 g/mL at 25 °C (lit.) |
| Boling Point | 170-172 °C(Press: 743 Torr) |
| Flash Point | 82°F |
| Vapor Presure | 0.689mmHg at 25°C |
| Appearance | Liquid |
| Color | Clear colorless |
| BRN | 1209886 |
| Storage Condition | 2-8°C |
| Refractive Index | n20/D 1.399(lit.) |
| MDL | MFCD00009229 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R10 - Flammable R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S16 - Keep away from sources of ignition. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | UN 3272 3/PG 3 |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 9-21 |
| HS Code | 29153900 |
| Hazard Class | 3.2 |
| Packing Group | III |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |