| Name | 1,2-Cyclohexanedione |
| Synonyms | AI3-25042 NSC 32950 CCRIS 6296 BRN 0507419 1,2-Cyclohexadione 1,2-Cyclohexanedione 1,2-Dioxocyclohexane Cyclohexane-1,2-dione cyclohexane-1,2-dione Two1,2-cyclohexylketone 4-07-00-01982 (Beilstein Handbook Reference) |
| CAS | 765-87-7 |
| EINECS | 212-155-3 |
| InChI | InChI=1/C12H18O3/c1-3-7-11-9(5-1)13-12(15-11)8-4-2-6-10(12)14-11/h9-10H,1-8H2 |
| Molecular Formula | C6H8O2 |
| Molar Mass | 112.13 |
| Density | 1,118 g/cm3 |
| Melting Point | 34-38 °C (lit.) |
| Boling Point | 193-195 °C (lit.) |
| Flash Point | 184°F |
| JECFA Number | 424 |
| Water Solubility | Soluble |
| Appearance | Bright yellow solid |
| Color | Clear yellow |
| BRN | 507419 |
| Storage Condition | 2-8°C |
| Sensitive | Argon filling operation and storage |
| Refractive Index | 1.518-1.52 |
| MDL | MFCD00001648 |
| Physical and Chemical Properties | Colorless oil. Melting point 38-40 °c, boiling point 193-195 °c, 85 °c (2.3kPa). Soluble in ethanol, ether, insoluble in water. |
| Use | Specific Reagents for Arginine Residues |
| Risk Codes | 22 - Harmful if swallowed |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| RTECS | GV0340000 |
| FLUKA BRAND F CODES | 8 |
| TSCA | Yes |
| HS Code | 29142990 |
| Hazard Note | Irritant |
| FEMA | 3458 | 2-HYDROXY-2-CYCLOHEXEN-1-ONE |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | 1, 2-cyclohexanedione has been used as a substrate for the Study of cyclohexane -1,2-diketone Hydrolase as a new tool for the degradation of cycloaliphatic compounds. used in organic synthesis. |
| biological activity | 1,2-Cyclohexanedione is an endogenous metabolite. |
| production method | Cyclohexanone is heated to 70-80 °c, and an ethanol solution containing selenium dioxide is added dropwise, maintaining the reaction temperature at 70-80 °c, after completion of the dropwise addition, the mixture was heated and refluxed for 2 hours. Then, an evaporation operation was performed, and the precipitated selenium was separated, distilled under reduced pressure, and purified to obtain 1, 2-cyclohexanedione. |