| Name | Triphenylmethane |
| Synonyms | Tritan Triphenylmethan Triphenylmethane Benzhydrylbenzene methane,triphenyl- Methane, triphenyl- 1,1',1''-methanetriyltribenzene 1,1',1''-methylidynetris-benzen Benzene,1,1',1 -methylidynetris- benzene,1,1',1''-methylidynetris- Benzene, 1,1',1''-methylidynetris- |
| CAS | 519-73-3 |
| EINECS | 208-275-0 |
| InChI | InChI=1/C19H16/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,19H |
| Molecular Formula | C19H16 |
| Molar Mass | 244.33 |
| Density | 1.014g/mLat 25°C(lit.) |
| Melting Point | 92-94°C(lit.) |
| Boling Point | 358-359°C754mm Hg(lit.) |
| Flash Point | 358-359°C |
| Water Solubility | INSOLUBLE |
| Solubility | dioxane: 0.1g/mL, clear |
| Vapor Presure | 4.74E-05mmHg at 25°C |
| Appearance | Bright brown powder |
| Specific Gravity | 1.014 |
| Color | Faint yellow |
| Merck | 14,9741 |
| BRN | 1909753 |
| pKa | 31.5(at 25℃) |
| Storage Condition | Store below +30°C. |
| Stability | Stable; combustible. Incompatible with strong oxidizing agents. |
| Refractive Index | nD100 1.59546 |
| MDL | MFCD00004763 |
| Use | For Organic synthesis |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. S36 - Wear suitable protective clothing. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29029080 |
| Hazard Note | Irritant |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| Use | Used for dye synthesis, also used as gas chromatography stationary liquid Used for organic synthesis Organic synthesis intermediate. Triphenylmethane is used for the separation of aromatic hydrocarbon derivatives and general hydrocarbons |