| Name | Tristearin |
| Synonyms | Tristearin Glycerol Tristearate 1,2,3-Propanetriyl trioctadecanoate propane-1,2,3-triyl trioctadecanoate Octadecanoic acid, 1,2,3-propanetriyl ester |
| CAS | 555-43-1 |
| EINECS | 209-097-6 |
| InChI | InChI=1/C57H110O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-55(58)61-52-54(63-57(60)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)53-62-56(59)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h54H,4-53H2,1-3H3 |
| Molecular Formula | C57H110O6 |
| Molar Mass | 891.48 |
| Density | 0.909g/cm3 |
| Melting Point | 71-73℃ |
| Boling Point | 813°C at 760 mmHg |
| Flash Point | 299.4°C |
| Vapor Presure | 1.67E-26mmHg at 25°C |
| Appearance | White powder |
| Storage Condition | -20℃ |
| Refractive Index | 1.465 |
| MDL | MFCD00036230 |
| Physical and Chemical Properties | Melting Point: 71 - 73 |
| Use | Used in organic synthesis, also used as raw material and adhesive of soap |
| Reference Show more | 1. [IF=4.244] Pengfei Liu et al."Effects of glycerides with different molecular structures on the properties of maize starch and its film forming capacity."Ind Crop Prod. 2019 Mar;129:512 |