| Name | n-Tridecanoic acid |
| Synonyms | Tridecylsαure Tridecansαure n-tridecoicacid 1-Tridecansαure n-Tridecansαure Tridecanoicacid Tridecylic acid tridecanoic acid n-Tridecoic acid N-TRIDECYLIC ACID n-Tridecanoic acid RARECHEM AL BO 0427 |
| CAS | 638-53-9 |
| EINECS | 211-341-1 |
| InChI | InChI=1/C13H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h2-12H2,1H3,(H,14,15) |
| InChIKey | SZHOJFHSIKHZHA-UHFFFAOYSA-N |
| Molecular Formula | C13H26O2 |
| Molar Mass | 214.34 |
| Density | 0.9582 g/cm3 (20 ºC) |
| Melting Point | 41-42°C(lit.) |
| Boling Point | 236°C100mm Hg(lit.) |
| Flash Point | >230°F |
| Water Solubility | 33mg/L(20 ºC) |
| Solubility | Slightly soluble in water. |
| Vapor Presure | 0.000299mmHg at 25°C |
| Appearance | White to white-like powder. |
| Color | White to pale yellow |
| BRN | 508317 |
| pKa | 4.78±0.10(Predicted) |
| Storage Condition | room temp |
| Stability | Stable. Incompatible with bases, oxidizing agents, reducing agents. |
| Refractive Index | 1.4498 (589.3 nm 20℃ |
| MDL | MFCD00002741 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | YD3850000 |
| HS Code | 29159000 |
| FEMA | 4336 | TRIDECANOIC ACID |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| biological activity | Tridecanoic acid (Tridecylic acid) is a kind of food that is found in many kinds of food, such as nutmeg, melon, saturated fatty acids in black elderberry and coconut. |