| Name | 2,4-Thiazolidinedione |
| Synonyms | TZD Thiazolidinedione TIMTEC-BB SBB000047 OTAVA-BB BB7112440002 2,4-Thiazolidinedione 2,4-Dioxothiazolidine Thiazolidinedione-2,4 2,4-Thiadolidinedione thiazolidin-2,4-dione Thiazolidine-2,4-dione 2, 4 - Margaret diketone 2,4(3H,5H)-Thiazoledione 1,3-thiazolidine-2,4-dione |
| CAS | 2295-31-0 |
| EINECS | 218-941-2 |
| InChI | InChI=1/C3H3NO2S/c5-2-1-7-3(6)4-2/h1H2,(H,4,5,6) |
| InChIKey | ZOBPZXTWZATXDG-UHFFFAOYSA-N |
| Molecular Formula | C3H3NO2S |
| Molar Mass | 117.13 |
| Density | 1.408 (estimate) |
| Melting Point | 125-127 °C (lit.) |
| Boling Point | 178-179 °C (19 mmHg) |
| Flash Point | 178-179°C/19mm |
| Water Solubility | Soluble in water (30 mg/ml at 3°C), methanol, DMSO, ethanol, and ethyl ether. |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Vapor Presure | 0Pa at 25℃ |
| Appearance | White powder |
| Color | Slightly yellow |
| BRN | 110700 |
| pKa | 6.50±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5130 (estimate) |
| MDL | MFCD00005478 |
| Physical and Chemical Properties | Melting point 123-126°C boiling point 178-179°C (19 mmHg) |
| Use | For the synthesis of drugs such as pioglitazone, rosiglitazone |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S24/25 - Avoid contact with skin and eyes. S36 - Wear suitable protective clothing. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| RTECS | XJ5775000 |
| TSCA | Yes |
| HS Code | 29341000 |
| Hazard Class | IRRITANT |
| LogP | -0.29 at 25℃ |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | used to prepare pioglitazone and rosiglitazone. non-pancreatic bird dependent diabetes drugs, troglitazone (Troglitazone) pioglitazone (Piglitazone) and rosiglitazone (Rosiglitazone) and other thiazole sensitizers intermediates. used to synthesize drugs such as pioglitazone and rosiglitazone |