| Name | N-tritylglycine |
| Synonyms | Trt-Gly-OH TRT-GLY-OH TRT-GLYCINE TRITYL-GLYCINE N-tritylglycine N-TRITYLGLYCINE TIMTEC-BB SBB002954 N-ALPHA-TRITYL-GLYCINE N-Tritylglycine~Trt-Gly-OH N-(TRIPHENYLMETHYL)GLYCINE 5-{[(4-butoxyphenyl)carbonyl]amino}-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(tetrahydrofuran-2-ylmethyl)benzamide |
| CAS | 5893-05-0 |
| EINECS | 1533716-785-6 |
| InChI | InChI=1/C34H42N4O5/c1-3-4-21-42-27-14-11-25(12-15-27)33(39)36-26-13-16-30(29(23-26)34(40)35-24-28-8-7-22-43-28)37-17-19-38(20-18-37)31-9-5-6-10-32(31)41-2/h5-6,9-16,23,28H,3-4,7-8,17-22,24H2,1-2H3,(H,35,40)(H,36,39) |
| Molecular Formula | C21H19NO2 |
| Molar Mass | 317.38 |
| Density | 1.178±0.06 g/cm3(Predicted) |
| Melting Point | 172-174°C |
| Boling Point | 480.0±33.0 °C(Predicted) |
| Flash Point | 387.8°C |
| Solubility | almost transparency in Methanol |
| Vapor Presure | 1.91E-20mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Almost white |
| BRN | 1998718 |
| pKa | 2.14±0.10(Predicted) |
| Storage Condition | Sealed in dry,Store in freezer, under -20°C |
| Refractive Index | 1.602 |
| MDL | MFCD00004276 |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |