| Name | tris(4-fluorophenyl)phosphine |
| Synonyms | TRI(4-FLUOROPHENYL)PHOSPHINE tri(4-fluorophenyl)phosphine Tris(4-Flurophenyl)Phosphine tris(4-fluorophenyl)phosphine Tri-(p-fluorophenyl)phosphine TRIS(4-FLUOROPHENYL)PHOSPHINE TRIS(P-FLUOROPHENYL)PHOSPHINE tris(p-fluorophenyl)phosphine phosphine, tris(p-fluorophenyl)- Phosphine, tris(p-fluorophenyl)- |
| CAS | 18437-78-0 |
| InChI | InChI=1/C9H11NO2/c1-6-7(9(11)12-2)4-3-5-8(6)10/h3-5H,10H2,1-2H3 |
| InChIKey | GEPJPYNDFSOARB-UHFFFAOYSA-N |
| Molecular Formula | C18H12F3P |
| Molar Mass | 316.26 |
| Density | 1.132g/cm3 |
| Melting Point | 79-83°C(lit.) |
| Boling Point | 160°C/0.1mmHg(lit.) |
| Flash Point | 142.7°C |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 0.00301mmHg at 25°C |
| Appearance | Solid |
| Color | White to very slightly yellow |
| BRN | 919838 |
| Storage Condition | Inert atmosphere,Room Temperature |
| Sensitive | Air Sensitive |
| Refractive Index | 1.558 |
| MDL | MFCD00013553 |
| Physical and Chemical Properties | Sensitivity: Air Sensitive WGK Germany:3 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29319090 |
| Hazard Class | IRRITANT |