| Name | Tri-n-propylsilane |
| Synonyms | NSC 96837 tripropylsilyl Tripropylsilane tripropyl-silan TRIPROPYLSILANE Silane, tripropyl- TRI-N-PROPYLSILANE Tri-n-propylsilane SILICON TRI-N-PROPYL 1-(Dipropylsilyl)propane |
| CAS | 998-29-8 |
| EINECS | 213-649-1 |
| InChI | InChI=1/C9H21Si/c1-4-7-10(8-5-2)9-6-3/h4-9H2,1-3H3 |
| Molecular Formula | C9H22Si |
| Molar Mass | 158.36 |
| Density | 0.758g/mLat 25°C(lit.) |
| Boling Point | 171°C(lit.) |
| Flash Point | 110°F |
| Specific Gravity | 0.758 |
| BRN | 1733500 |
| Storage Condition | Flammables area |
| Sensitive | 3: reacts with aqueous base |
| Refractive Index | n20/D 1.426(lit.) |
| MDL | MFCD00009358 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R10 - Flammable R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | UN 1993 3/PG 3 |
| WGK Germany | 1 |
| TSCA | Yes |
| HS Code | 29310099 |
| Hazard Class | 3 |
| Packing Group | III |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |