| Name | Trimesitylphosphine |
| Synonyms | Trimesitylphosphine TRIMESITYLPHOSPHINE Trismesitylphosphine TRIS(2,4,6-TRIMETHYLPHENYL)PHOSPHINE tris(2,4,6-trimethylphenyl)phosphane phosphine, tris(2,4,6-trimethylphenyl)- |
| CAS | 23897-15-6 |
| InChI | InChI=1/C27H33P/c1-16-10-19(4)25(20(5)11-16)28(26-21(6)12-17(2)13-22(26)7)27-23(8)14-18(3)15-24(27)9/h10-15H,1-9H3 |
| Molecular Formula | C27H33P |
| Molar Mass | 388.52 |
| Melting Point | 185-188 °C (lit.) |
| Boling Point | 491.1±45.0 °C(Predicted) |
| Flash Point | 266.2°C |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 2.6E-09mmHg at 25°C |
| Appearance | Powder |
| Color | white |
| Storage Condition | Inert atmosphere,Room Temperature |
| MDL | MFCD00014912 |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29319090 |