| Name | Tripropyleneglycolmonomethylether |
| Synonyms | TPM Arcosolv Tpm DOWANOL(TM) TPM ARCOSOLV (R) TPM Tripropyleneglycolmonomethylether Tripropylene glycol monomethyl ether Triisopropylene glycol monomethyl ether 1,4,7-Trimethyl-3,6,9-trioxadecane-1-ol 1[2-(2-METHOXY-1-METHYLETHOXY)-1-METHYLETHOXY]-2-PROPANOL 1-({1-[(1-methoxypropan-2-yl)oxy]propan-2-yl}oxy)propan-2-ol |
| CAS | 20324-33-8 |
| EINECS | 243-734-9 |
| InChI | InChI=1/C9H20O4.C2H6O/c1-7(11)5-12-9(3)6-13-8(2)4-10;1-3-2/h7-11H,4-6H2,1-3H3;1-2H3 |
| Molecular Formula | C10H22O4 |
| Molar Mass | 206.28 |
| Density | 0.976 |
| Melting Point | 25°C |
| Boling Point | 243°C |
| Flash Point | >110℃ |
| Vapor Presure | 1.36E-05mmHg at 25°C |
| Specific Gravity | 0.969 |
| pKa | 14.41±0.20(Predicted) |
| Refractive Index | 1.4389 (estimate) |
| Safety Description | S23 - Do not breathe vapour. S24/25 - Avoid contact with skin and eyes. |
| HS Code | 29094990 |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |