| Name | 2,5-dihydroxytoluene |
| Synonyms | THQ TOLUHYDROQUINONE Toluhydroquinone P-TOLUHYDROQUINOL P-TOLUHYDROQUINONE METHYLHYDROQUINONE 2-METHYLHYDROQUINONE 2-Methylhydroquinone 2,5-dihydroxytoluene 2,5-DIHYDROXYTOLUENE O-Methylhydroquinone 2-Methyl Hydroquinone O-Methyl hydroquinone 2-Methyl-1,4-benzenediol 2-methylbenzene-1,4-diol 2-METHYL-1,4-BENZENEDIOL 3-METHYL-1,4-DIHYDROXYBENZENE |
| CAS | 95-71-6 |
| EINECS | 202-443-7 |
| InChI | InChI=1/C7H8O2/c1-5-4-6(8)2-3-7(5)9/h2-4,8-9H,1H3 |
| InChIKey | CNHDIAIOKMXOLK-UHFFFAOYSA-N |
| Molecular Formula | C7H8O2 |
| Molar Mass | 124.14 |
| Density | 1.1006 (rough estimate) |
| Melting Point | 128-130°C(lit.) |
| Boling Point | 285°C |
| Flash Point | 172 °C |
| Water Solubility | 77 g/L (25 ºC) |
| Solubility | 77g/l |
| Vapor Presure | 0.004Pa at 25℃ |
| Appearance | White crystal |
| Color | Grayish-white to light beige |
| BRN | 2041489 |
| pKa | pK1:10.03;pK2:11.62 (25°C) |
| Storage Condition | Store below +30°C. |
| Stability | Stable. Combustible. Incompatible with oxidizing agents, strong bases. |
| Refractive Index | 1.4922 (estimate) |
| MDL | MFCD00002345 |
| Physical and Chemical Properties | Melting point 125-128°C flash point 172°C water-soluble 77g/L (25°C) |
| Use | Used as medicine, dye, pigment intermediates, antioxidants, is also a new type of polymerization inhibitor |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | 2811 |
| WGK Germany | 2 |
| RTECS | MX6700000 |
| TSCA | Yes |
| HS Code | 29072900 |
| Hazard Class | 6.1(b) |
| Packing Group | III |
| Toxicity | LD50 orally in Rabbit: 200 - 400 mg/kg |
| LogP | 0.9 at 27℃ |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Application | is mainly used for pigments, dyes, pharmaceutical intermediates. used as medicine, dye, pigment intermediate, antioxidant, is also a new type of polymerization inhibitor |
| autoignition temperature | 851 ° F. |