| Name | Scopine |
| Synonyms | SCOPINE Scopine Atropine Impurity 2 9-methyl-3-oxa-9-azatricyclo[3.3.1.0~2,4~]nonan-7-ol (1α,2β,4β,5α)-9-Methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7β-ol (1R,2R,4S,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.0~2,4~]nonan-7-ol (1R,2R,4S,5S,7s)-9-Methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-ol (1β,2α,4α,5β,7α)-9-Methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-ol 3-Oxa-9-azatricyclo[3.3.1.02,4]nonan-7-ol,9-Methyl-, (1a,2b,4b,5a,7b)- (1alpha,2beta,4beta,5alpha,7beta)-9-Methyl-3-oxa-9-azatricyclo[3.3.1.02.4]nonan-7-ol |
| CAS | 498-45-3 |
| EINECS | 102-503-4 |
| InChI | InChI=1/C8H13NO2/c1-9-5-2-4(10)3-6(9)8-7(5)11-8/h4-8,10H,2-3H2,1H3/t4?,5-,6+,7-,8+ |
| InChIKey | FIMXSEMBHGTNKT-RZVDLVGDSA-N |
| Molecular Formula | C8H13NO2 |
| Molar Mass | 155.2 |
| Density | 1.284±0.06 g/cm3(Predicted) |
| Melting Point | 73.0 to 77.0 °C |
| Boling Point | 281.3±40.0 °C(Predicted) |
| Flash Point | 123.9°C |
| Solubility | DMSO 31 mg/mL Water 31 mg/mL Ethanol 31 mg/mL |
| Vapor Presure | 0.000427mmHg at 25°C |
| Appearance | Solid |
| Color | White |
| pKa | 14?+-.0.20(Predicted) |
| Storage Condition | Inert atmosphere,Store in freezer, under -20°C |
| Refractive Index | 1.573 |
| Use | A metabolite of scopolamine |
| HS Code | 29349990 |
| Biological activity | Scopine is a Anisodine metabolite and an α1-adrenergic receptor agonist used to treat acute circulatory shock. |
| Target | Value |