| Name | Succinamide |
| Synonyms | SUCCINAMIDE Succinamide butanediamide SUCCINDIAMIDE Butanediamide Succinic amide Succinic diamide SUCCINIC DIAMIDE SUCCINIC ACID AMIDE SUCCINIC ACID DIAMIDE Butanedioic acid diamide |
| CAS | 110-14-5 |
| EINECS | 203-739-9 |
| InChI | InChI=1/C4H8N2O2/c5-3(7)1-2-4(6)8/h1-2H2,(H2,5,7)(H2,6,8) |
| Molecular Formula | C4H8N2O2 |
| Molar Mass | 116.12 |
| Density | 1.2829 (rough estimate) |
| Melting Point | 260-265 °C (dec.) (lit.) |
| Boling Point | 217.15°C (rough estimate) |
| Flash Point | 252.6°C |
| Water Solubility | Slightly soluble in water. |
| Solubility | cold water: soluble220 part |
| Vapor Presure | 6.7E-10mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Almost white |
| Merck | 14,8866 |
| BRN | 1753983 |
| pKa | 15.88±0.40(Predicted) |
| Storage Condition | Store below +30°C. |
| Refractive Index | 1.4880 (estimate) |
| MDL | MFCD00008042 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 43 - May cause sensitization by skin contact |
| Safety Description | 36/37 - Wear suitable protective clothing and gloves. |
| WGK Germany | 3 |
| TSCA | Yes |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |