| Name | 1,3-bis(2,4,6-trimethylphenyl)-imidazolidinium-chloride |
| Synonyms | SIMes.HCl 1,3-Bis(2 1,3-Bis-(2,4,6-trimethylphenyl)imidazolidinium 1,3-Bis(2,4,6-trimethylphenyl)-imidazolidinium-chlorid 1,3-bis(2,4,6-trimethylphenyl)-imidazolidinium-chloride 1,3-BIS(2,4,6-TRIMETHYLPHENYL)-IMIDAZOLIDINIUM-CHLORIDE N,Nμ-(2,4,6-Trimethylphenyl)dihydroimidazolium chloride N,Nμ-(2,4,6-Trimethylphenyl)dihydroimidazolium chloride 1,3-Bis-(2,4,6-trimethyl-phenyl)-imidazolidin-1-ium chloride 1,3-bis-(2,4,6-trimethylphenyl)-4,5-dihydro-1h-imidazolium chloride 1,3-BIS-(2,4,6-TRIMETHYLPHENYL)-4,5-DIHYDRO-1H-IMIDAZOLIUM CHLORIDE |
| CAS | 173035-10-4 |
| InChI | InChI=1/C21H28N2.ClH/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;/h9-12H,7-8,13H2,1-6H3;1H |
| InChIKey | COGMCBFILULEOS-UHFFFAOYSA-M |
| Molecular Formula | C21H29ClN2 |
| Molar Mass | 344.92 |
| Melting Point | 280-286°C |
| Appearance | Beige to Pink-Brown Powder |
| Color | Beige to pink-brown |
| Storage Condition | Inert atmosphere,Room Temperature |
| Sensitive | air sensitive |
| MDL | MFCD09039279 |
| Use | N-Heterocyclic Carbene Ligands Precursor to an N-heterocyclic carbene catalysts |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29332990 |
| use | important pharmaceutical intermediates |