| Name | 3-(1-Naphthyl)acrylic acid |
| Synonyms | NSC99085 SBB015717 ARONIS000886 EINECS 235-887-5 1-Naphthylacrylic acid 3-(1-NAPHTHYL)ACRYLIC ACID 3-(1-Naphthyl)acrylic acid 3-NAPHTHALEN-1-YL-ACRYLIC ACID 3-(1-NAPHTHYL)PROP-2-ENOIC ACID (2E)-3-naphthalen-1-ylprop-2-enal 3-naphthalen-1-ylprop-2-enoic acid (2E)-3-naphthalen-1-ylprop-2-enoate (2E)-3-(naphthalen-1-yl)prop-2-enoic acid |
| CAS | 13026-12-5 |
| EINECS | 235-887-5 |
| InChI | InChI=1/C13H10O2/c14-13(15)9-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-9H,(H,14,15)/p-1/b9-8+ |
| Molecular Formula | C13H10O2 |
| Molar Mass | 198.22 |
| Density | 1.245±0.06 g/cm3(Predicted) |
| Melting Point | 210-212°C |
| Boling Point | 393.1±11.0 °C(Predicted) |
| Flash Point | 290.7°C |
| Water Solubility | Slightly soluble in water. |
| Vapor Presure | 6.95E-07mmHg at 25°C |
| Appearance | White to light brown powder |
| BRN | 1868617 |
| pKa | 4.46±0.30(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| MDL | MFCD00014317 |
| Physical and Chemical Properties | White crystal powder. |
| Use | For Organic synthesis |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S37 - Wear suitable gloves. |
| Hazard Class | IRRITANT |
| chemical properties | white crystal powder. |
| use | for organic synthesis |
| NIST chemical information | The information is provided by: webbook.nist.gov (external link) |