| Name | ramifenazone |
| Synonyms | isopyrin ramifenazone RAMIFENAZONE Ramiphenazone 4-Isopropylaminoantipyrine 4-isopropylamino-2,3-dimethyl-1-phenyl-3-pyrazolin-5-one 1,2-Dihydro-1,5-dimethyl-4-isopropylamino-2-phenyl-3H-pyrazol-3-one 1,5-dimethyl-2-phenyl-4-(propan-2-ylamino)-1,2-dihydro-3H-pyrazol-3-one 3H-Pyrazol-3-one, 1,2-dihydro-1,5-dimethyl-4-(1-methylethyl)amino-2-phenyl- 1,2-Dihydro-1,5-dimethyl-4-[(1-methylethyl)amino]-2-phenyl-3H-pyrazol-3-one |
| CAS | 3615-24-5 |
| EINECS | 222-791-3 |
| InChI | InChI=1/C14H19N3O/c1-10(2)15-13-11(3)16(4)17(14(13)18)12-8-6-5-7-9-12/h5-10,15H,1-4H3 |
| Molecular Formula | C14H19N3O |
| Molar Mass | 245.32 |
| Density | 1.0516 (rough estimate) |
| Melting Point | 80° |
| Boling Point | 388.28°C (rough estimate) |
| Flash Point | 164.6°C |
| Solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| Vapor Presure | 5E-05mmHg at 25°C |
| Appearance | Solid |
| Color | Off-White |
| pKa | 4.27±0.20(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.5700 (estimate) |
| Toxicity | LD50 in mice (mg/kg): 843 i.p.; 1070 orally (Tubaro) |
| 1mg | 5mg | 10mg | |
|---|---|---|---|
| 1 mM | 4.076 ml | 20.382 ml | 40.763 ml |
| 5 mM | 0.815 ml | 4.076 ml | 8.153 ml |
| 10 mM | 0.408 ml | 2.038 ml | 4.076 ml |
| 5 mM | 0.082 ml | 0.408 ml | 0.815 ml |
| introduction | isopropylaminopyrine is a drug and personal care products (pharmaceutical and personal care, PPCPs) compound. The concentration of PPCPs in water is very low, usually at ng · L-1 level. Du Wei et al. used direct injection to detect PPCPs as low as ng · L-1 concentration in environmental water, which simplified the pretreatment process and significantly improved the detection flux. |
| biological activity | Ramifenazone (Isopropylaminoantipyrine) is a pyrazole derivative, as a non-steroidal anti-inflammatory reagent (NSAID). Ramifenazone has analgesic, antipyretic, anti-inflammatory and antibacterial activities. |
| use | as an anti-inflammatory analgesic |