| Name | Propylcyclohexanecarboxylicacid |
| Synonyms | 3HA Polychloronapthalene propylcyclohexanecarboxylicacid Propylcyclohexanecarboxylicacid Propyl Cyclohexyl Carboxylic Acid 4α-Propylcyclohexane-1β-carboxylic acid trans-4-Propylcyclohexanecarboxylic acid trans-4-n-Propylcyclohexanecarboxylic acid trans-4-(Prop-1-yl)cyclohexanecarboxylic acid Trans-4-PropylcyclohexaneCarboxylicAcid,3HaC10H18O2 |
| CAS | 38289-27-9 |
| EINECS | 679-815-4 |
| InChI | InChI=1/C10H18O2/c1-2-3-8-4-6-9(7-5-8)10(11)12/h8-9H,2-7H2,1H3,(H,11,12)/t8-,9- |
| Molecular Formula | C10H18O2 |
| Molar Mass | 170.25 |
| Density | 0.985±0.06 g/cm3(Predicted) |
| Melting Point | 93°C |
| Boling Point | 270.3±8.0 °C(Predicted) |
| Flash Point | 129.5°C |
| Solubility | soluble in Methanol |
| Vapor Presure | 0.00195mmHg at 25°C |
| Appearance | Bright yellow crystalline powder |
| Color | White to Almost white |
| pKa | 4.92±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.464 |
| MDL | MFCD00059559 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R36 - Irritating to the eyes |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S60 - This material and its container must be disposed of as hazardous waste. S37 - Wear suitable gloves. |
| HS Code | 29162090 |