| Name | Thionicotinamide |
| Synonyms | Thionicotinamide THIONICOTINAMIDE 3-thioamidopyridine PYRIDINE-3-THIOAMIDE 3-pyridylthioformamide 3-pyridinecarbothioamide 3-pyridinethiocarboxamide PYRIDINE-3-CARBOTHIOAMIDE Pyridine-3-carbothioamide Pyridine-3-thiocarboxamide PYRIDINE-3-CARBOTHIOIC ACID AMIDE |
| CAS | 4621-66-3 |
| EINECS | 225-036-6 |
| InChI | InChI=1/C6H6N2S/c7-6(9)5-2-1-3-8-4-5/h1-4H,(H2,7,9) |
| InChIKey | XQWBMZWDJAZPPX-UHFFFAOYSA-N |
| Molecular Formula | C6H6N2S |
| Molar Mass | 138.19 |
| Density | 1.235 (estimate) |
| Melting Point | 185-190 °C |
| Boling Point | 278.9±32.0 °C(Predicted) |
| Flash Point | 160 °C |
| Vapor Presure | 0.00415mmHg at 25°C |
| Appearance | Powder |
| Color | Yellow to yellow-green |
| BRN | 109593 |
| pKa | 12.01±0.29(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.5300 (estimate) |
| MDL | MFCD00006399 |
| Use | Used as a pharmaceutical Intermediate |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S24/25 - Avoid contact with skin and eyes. S36 - Wear suitable protective clothing. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| RTECS | QS4488000 |
| TSCA | Yes |
| HS Code | 29333990 |
| Hazard Class | IRRITANT |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | as a pharmaceutical intermediate |