| Name | dicyclohexylphenylphosphine |
| Synonyms | 229-334-7 Dicyclohexyphenylphosphine dicyclohexylphenyl-phosphin dicyclohexylphenylphosphine phenyldicyclohexylphosphine DICYCLOHEXYLPHENYLPHOSPHINE PHENYLPHOSPHINODICYCLOHEXANE dicyclohexyl(phenyl)phosphane phosphine, dicyclohexylphenyl- Phosphine, dicyclohexylphenyl- PHENYLDICYCLOHEXYLPHOSPHINE(PHPCY2) |
| CAS | 6476-37-5 |
| EINECS | 229-334-7 |
| InChI | InChI=1/C18H27P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1,4-5,10-11,17-18H,2-3,6-9,12-15H2 |
| Molecular Formula | C18H27P |
| Molar Mass | 274.38 |
| Melting Point | 60-61 °C (lit.) |
| Boling Point | 391.8±11.0 °C(Predicted) |
| Flash Point | 201.1°C |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 5.43E-06mmHg at 25°C |
| Appearance | Crystalline Powder |
| Color | White to off-white |
| Storage Condition | Room Temprature |
| Sensitive | Air Sensitive |
| MDL | MFCD00003854 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 22 - Harmful if swallowed |
| Safety Description | 36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | SY9125000 |
| TSCA | No |
| HS Code | 29310099 |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| properties | phenyldicyclohexylphosphine is a white to off-white crystalline powder. |
| Use | phenyldicyclohexylphosphine is an organic phosphine compound and can be used as a raw material for organic synthesis. |