| Name | Phenylurea |
| Synonyms | PHENYLUREA Phenylurea phenyl-ure 1-Phenylurea N-PHENYLUREA Monophenylurea PHENYLCARBAMIDE phenylureapesticide,liquid,poisonous phenylureapesticide,liquid,flammable,poisonous |
| CAS | 64-10-8 |
| EINECS | 200-576-5 |
| InChI | InChI=1/C7H8N2O/c8-7(10)9-6-4-2-1-3-5-6/h1-5H,(H3,8,9,10) |
| InChIKey | LUBJCRLGQSPQNN-UHFFFAOYSA-N |
| Molecular Formula | C7H8N2O |
| Molar Mass | 136.15 |
| Density | 1,302 g/cm3 |
| Melting Point | 145-147°C(lit.) |
| Boling Point | 238 °C |
| Flash Point | 238°C |
| Water Solubility | Soluble in water. |
| Solubility | H2O: 10mg/mL, clear |
| Vapor Density | >1 (vs air) |
| Appearance | Powder, Crystals and/or Chunks |
| Color | White to light yellow |
| Merck | 14,7319 |
| BRN | 1934615 |
| pKa | 13.37±0.50(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Refractive Index | 1.5769 (estimate) |
| MDL | MFCD00007944 |
| Physical and Chemical Properties | Colorless needle-like crystals. The melting point of 147 deg C (decomposition), boiling point of 238 deg C. Dissolve in hot water, hot alcohol, ether, ethyl acetate and acetic acid. |
| Use | Pharmaceutical Intermediates |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 22 - Harmful if swallowed |
| Safety Description | S22 - Do not breathe dust. S36/37 - Wear suitable protective clothing and gloves. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| RTECS | YU0650000 |
| TSCA | Yes |
| HS Code | 29242100 |
| Toxicity | LD50 oral in rat: 2gm/kg |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | for organic synthesis. pharmaceutical intermediates |
| production method | is obtained by reacting aniline with urea. The urea, hydrochloric acid and aniline were put into the reaction Pan, heated and stirred, and refluxed at 100-104 ° C. For 1H. After the reaction, water was added, stirred, cooled, filtered, and the filter cake was washed with water and dried to obtain the finished product. |