| Name | Chloropentafluorobenzene |
| Synonyms | Pentafluorochlorobenzol Pentafluorochlorobenzene Chloropentafluorobenzene PENTAFLUOROCHLOROBENZENE 1-Chloropentafluorobenzene 1,2,3,4,5-Pentafluoro-6-chlorobenzene 1-Chloro-2,3,4,5,6-pentafluorobenzene 1-chloro-2,3,4,5,6-pentafluoro-benzene |
| CAS | 344-07-0 |
| EINECS | 206-450-6 |
| InChI | InChI=1/C6ClF5/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| Molecular Formula | C6ClF5 |
| Molar Mass | 202.51 |
| Density | 1.568 g/mL at 25 °C (lit.) |
| Melting Point | -15.66°C |
| Boling Point | 122-123 °C/750 mmHg (lit.) |
| Flash Point | 116-118°C |
| Appearance | Liquid |
| Specific Gravity | 1.651.568 |
| Color | Clear colorless |
| BRN | 1819389 |
| Storage Condition | Refrigerator |
| Refractive Index | n20/D 1.424(lit.) |
| MDL | MFCD00000534 |
| Physical and Chemical Properties | Colorless to yellowish liquid, boiling point 122 ℃-123 ℃(750mmHg), refractive index 1.4230, specific gravity 1.568. |
| Risk Codes | R20 - Harmful by inhalation R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S23 - Do not breathe vapour. S24/25 - Avoid contact with skin and eyes. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 2 |
| RTECS | CZ1225500 |
| TSCA | T |
| HS Code | 29039990 |
| Hazard Note | Irritant |
| Toxicity | dns-rat:lvr 10 mg/L NTIS** AD-A165-849 |
| chemical properties | colorless to yellowish liquid, boiling point 122 ℃-123 ℃(750mmHg), refractive index 1.4230, specific gravity 1.568. |
| uses | intermediates in medicine, pesticides and liquid crystal materials. |
| EPA chemical information | information provided by: ofmpub.epa.gov (external link) |