| Name | pentafluorothiophenol |
| Synonyms | pentafluorothiophenol PENTAFLUOROTHIOPHENOL PENTAFLUOROBENZENETHIOL pentafluoro-benzenethio PENTAFLUOROPHENYL MERCAPTAN 2,3,4,5,6-Pentafluorothiphenol 2,3,4,5,6-PENTAFLUOROTHIOPHENOL 2,3,4,5,6-Pentafluorobenzenethiol |
| CAS | 771-62-0 |
| EINECS | 212-236-3 |
| InChI | InChI=1/C6HF5S/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
| Molecular Formula | C6HF5S |
| Molar Mass | 200.12 |
| Density | 1.5 |
| Melting Point | -24℃ |
| Boling Point | 143℃ |
| Flash Point | 51℃ |
| Water Solubility | Insoluble in water. |
| Refractive Index | 1.463 |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | R10 - Flammable R34 - Causes burns |
| Safety Description | S16 - Keep away from sources of ignition. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 2920 8/PG 2 |
| storage conditions | Flammables area |
| acidity coefficient (pKa) | 3? -. 0.50(Predicted) |
| morphology | Liquid |
| color | Clear colorless to slightly yellow |
| Specific gravity | 1.501 |
| water solubility | Insoluble in water. |
| sensitivity | Stench |
| BRN | 1876292 |
| WGK Germany | 3 |
| RTECS number | DC1940000 |
| F | 10-13-23 |
| Hazard Note | Toxic/Stench |
| HazardClass | 3 |
| PackingGroup | III |
| customs code | 29309090 |