| Name | N-(p-toluoyl)glycine |
| Synonyms | N-(p-toluoyl)glycine 4-METHYLHIPPURIC ACID PARA-METHYLHIPPURICACID p-Methylbenzoylaminoacetic acid 2-(4-Methylbenzamido)acetic acid 2-[(4-methylphenyl)formamido]acetic acid N-(4-Methylbenzoyl)glycine, p-Toluric acid 2-[[(4-methylphenyl)-oxomethyl]amino]acetic acid |
| CAS | 27115-50-0 |
| EINECS | 248-231-8 |
| InChI | InChI=1/C10H17NO3/c1-7-2-4-8(5-3-7)10(14)11-6-9(12)13/h7-8H,2-6H2,1H3,(H,11,14)(H,12,13)/p-1 |
| Molecular Formula | C10H11NO3 |
| Molar Mass | 193.2 |
| Density | 1.2307 (rough estimate) |
| Melting Point | 163-165 °C (lit.) |
| Boling Point | 329.41°C (rough estimate) |
| Flash Point | 212.7°C |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Vapor Presure | 1.58E-08mmHg at 25°C |
| Appearance | White crystalline powder |
| Color | White to Off-White |
| pKa | 3.72±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5300 (estimate) |
| MDL | MFCD00020449 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |