| Name | 4,4-Oxydiphthalic anhydride |
| Synonyms | ODPA s-ODPA S-ODPA Oxydiphthalicanhydride 4,4'-Oxydiphthalic Acid 4,4-Oxydiphthalic anhydride 4,4'-Oxydiphthalic anhydride 4,4'-Oxydiphthalic dianhydride Bis-(3-phthalyl anhydride) ether 5,5'-oxybis-3-isobenzofurandione 4,4''-Oxybisdiphthalic anhydride 4-4'-Oxydiphthalic acid anhydride 5,5'-oxybis(2-benzofuran-1,3-dione) |
| CAS | 1823-59-2 |
| EINECS | 412-830-4 |
| InChI | InChI=1/C16H6O7/c17-13-9-3-1-7(5-11(9)15(19)22-13)21-8-2-4-10-12(6-8)16(20)23-14(10)18/h1-6H |
| InChIKey | QQGYZOYWNCKGEK-UHFFFAOYSA-N |
| Molecular Formula | C16H6O7 |
| Molar Mass | 310.21 |
| Density | 1.665g/cm3 |
| Melting Point | 225-229℃ |
| Boling Point | 577.7°C at 760 mmHg |
| Flash Point | 260.7°C |
| Vapor Presure | 2.41E-13mmHg at 25°C |
| Appearance | White to white-like powder |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.694 |
| MDL | MFCD00039144 |
| Physical and Chemical Properties | Appearance: white crystalline powder Melting Point: 228-229 |
| Use | For composite materials, foams, adhesives, molded parts, films, etc |
| Risk Codes | R52/53 - Harmful to aquatic organisms, may cause long-term adverse effects in the aquatic environment. |
| Safety Description | S61 - Avoid release to the environment. Refer to special instructions / safety data sheets. |
| WGK Germany | 2 |
| HS Code | 29189900 |
Nature:
1. It is a white crystalline solid with an irritating odor.
2. It has good solubility in organic solvents, but is insoluble in water. It will decompose at high temperatures.
Usage:
1. Used as an intermediate in organic synthesis, for synthesizing polyester resins, dyes, and other organic compounds.
2. Used for preparing heat-resistant coatings, plastics, resins, etc.
Method:
4,4 '- oxobiphthalic anhydride is usually prepared by acylation reactions between phthalic acid and various anhydrides. The specific synthesis method can be selected based on specific experimental conditions and requirements.
Security information:
1. 4,4 '- Oxobiphthalic anhydride is an irritating compound that should be avoided from contact with the skin and inhalation of gases. Appropriate protective equipment should be worn during operation.
2. Avoid contact with strong oxidants and acids to reduce their likelihood of decomposition or reaction.
3. During storage and use, high temperatures and sources of fire should be avoided to prevent their decomposition and the generation of toxic substances or fires.
4. Maintain good ventilation during use and avoid prolonged exposure to steam.
5. When operating and storing, please comply with relevant safety operating procedures and take corresponding protective measures based on the information provided in the chemical safety data sheet.
Introduction 4,4 '-oxybis-phthalic anhydride is a white to white powder organic substance that can be used to make polyimide resins.
Application 4,4 '-oxybis-phthalic anhydride (ODPA) can be used to prepare composite materials, foams, adhesives, molded parts, films, etc.
Chemical properties white to white powder
Uses for composite materials, foams, adhesives, molded parts, films, etc.
Uses are used to make polyimide resins, etc.