N,N-dimethyl-2-chloroacetamide - Names and Identifiers
| Name | 2-chloro-N,N-dimethylacetamide
|
| Synonyms | AKOS BBS-00000943 CHLOROACETYLDIMETHYLAMINE N,N-DIMETHYLCHOROACETAMIDE N,N-DIMETHYLCHLOROACETAMIDE N,N-dimethyl-2-chloroacetamide 2-CHLORO-N,N-DIMETHYLACETAMIDE 2-chloro-N,N-dimethylacetamide N,N-DIMETHYL-2-CHLOROACETAMIDE N,N-dimethyl-2-chloro acetamide 2-chloro-N,N-dimethyl-ethanamide 2-Chloro-N,N-Dimethyl Butylamine 2-Chloro-N,N-dimethylacetacetamide
|
| CAS | 2675-89-0
|
| EINECS | 220-224-4 |
| InChI | InChI=1/C4H8ClNO/c1-6(2)4(7)3-5/h3H2,1-2H3 |
| InChIKey | XBPPLECAZBTMMK-UHFFFAOYSA-N |
N,N-dimethyl-2-chloroacetamide - Physico-chemical Properties
| Molecular Formula | C4H8ClNO
|
| Molar Mass | 121.57 |
| Density | 1.182 g/mL at 20 °C (lit.) |
| Melting Point | 15-16 °C |
| Boling Point | 98-100°C/11mm |
| Flash Point | 98-100°C/11mm |
| Solubility | Chloroform (Slightly), Hexane (Slightly), Methanol (Slightly) |
| Vapor Presure | 1.28mmHg at 25°C |
| Appearance | Liquid |
| Color | Clear colorless to pale yellow |
| BRN | 969568 |
| pKa | -0.95±0.70(Predicted) |
| Storage Condition | Store below +30°C. |
| Refractive Index | n20/D 1.479 |
N,N-dimethyl-2-chloroacetamide - Risk and Safety
| Hazard Symbols | C - Corrosive

|
| Risk Codes | R22 - Harmful if swallowed
R34 - Causes burns
|
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection.
S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.)
|
| UN IDs | UN 3265 8/PG 3 |
| WGK Germany | 3 |
| HS Code | 29241990 |
N,N-dimethyl-2-chloroacetamide - Introduction
2-choro-n, N-dimethylacetamide, chemical formula C4H8ClNO, also often abbreviated as CDMA, is an organic compound. The following is a description of its nature, use, preparation and safety information:
Nature:
1. Appearance: 2-choro-n, the N-dimethylacetamide is colorless and transparent liquid.
2. Density: about 1.09 g/cm ^ 3.
3. Melting Point:-20 ℃.
4. Boiling point: about 165-169 ℃.
5. Solubility: Soluble in many organic solvents such as alcohols, ethers and ketones, and low solubility in water.
Use:
1. 2-chloro-N,N-dimethylacetamide is commonly used as a solvent in organic synthesis.
2. In organic synthesis, it can be used for catalytic reaction, acylation reaction, nucleophilic substitution reaction and synthesis of amine compounds.
3. The compound can also be used in the fields of paints, dyes and plastics.
Method:
2-chloro-N,N-dimethylacetamide is usually obtained by reacting dimethylacetamide with hydrogen chloride. The specific synthesis method is as follows:
Dimethylacetamide HCl → 2-chloro-N,N-dimethylacetamide
Safety Information:
1. 2-chloro-N,N-dimethylacetamide irritating, use should wear protective gloves and glasses.
2. Avoid direct contact with the skin and inhalation of its vapor.
3. If you accidentally touch your skin or splash into your eyes, rinse immediately with plenty of water for 30 minutes and seek medical help.
4. In storage and use, should avoid contact with strong oxidants.
5. Must be operated in a well-ventilated place.
Please follow the relevant regulations of laboratory safety when using 2-chloro-N,N-dimethylacetamide, and operate according to the safety data form of chemicals.
Last Update:2024-04-10 22:29:15