| Name | N,N-diisobutylformamide |
| Synonyms | Diisobutylformamid N,N-DIISOBUTYLFORMAMIDE N,N-diisobutylformamide N,N-bis(2-methylpropyl)formamide N,N-Bis(2-methylpropyl)formamide N,N-bis(2-Methylpropyl)MethanaMide Formamide, N,N-bis(2-methylpropyl)- |
| CAS | 2591-76-6 |
| EINECS | 219-983-4 |
| InChI | InChI=1/C9H19NO/c1-8(2)5-10(7-11)6-9(3)4/h7-9H,5-6H2,1-4H3 |
| Molecular Formula | C9H19NO |
| Molar Mass | 157.25 |
| Density | 0.872[at 20℃] |
| Boling Point | 226-228°C |
| Flash Point | 90°C |
| Water Solubility | 13g/L at 20℃ |
| Vapor Presure | 6Pa at 20℃ |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Refractive Index | n20/D 1.442 |
| Safety Description | S23 - Do not breathe vapour. S24/25 - Avoid contact with skin and eyes. |
| LogP | 1.9 at 25℃ |