| Name | N,N-diisopropylaniline |
| Synonyms | N,N-DIISOPROPYLANILI N,N-DIISOPROPYLANILINE N,N-diisopropy aniline N,N-diisopropylaniline N,N-Diisopropylaniline diisopropyl(phenyl)amine N,N-Diisopropylbenzenamine N,N-di(propan-2-yl)aniline Benzenamine, N,N-bis(1-methylethyl)- |
| CAS | 4107-98-6 |
| EINECS | 696-162-0 |
| InChI | InChI=1/C12H19N/c1-10(2)13(11(3)4)12-8-6-5-7-9-12/h5-11H,1-4H3 |
| Molecular Formula | C12H19N |
| Molar Mass | 177.29 |
| Density | 0.91g/mLat 25°C(lit.) |
| Melting Point | -45°C (estimate) |
| Boling Point | 95-96°C11mm Hg(lit.) |
| Flash Point | 183°F |
| Vapor Presure | 0.0359mmHg at 25°C |
| Appearance | Liquid |
| Color | Colorless to pale yellow |
| pKa | 8.05±0.20(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Sensitive | Light Sensitive |
| Refractive Index | n20/D 1.519(lit.) |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |