Mepivacaine
Mepivacaine
CAS: 22801-44-1
Molecular Formula: C15H22N2O
Mepivacaine - Names and Identifiers
| Name | Mepivacaine |
| Synonyms | Mepivacaine MEPIVACAINE MepivacaineBase Mepivacaine HCl (base) N-(2,6-Dimethylphenyl)-1-Piperidinecarboxamide N-(2,6-dimethylphenyl)-1-methyl-2-piperidinecarboxamide N-(2,6-Dimethylphenyl)-1-methylpiperidine-2-carboxamide N-(2,6-Dimethylphenyl)-1-methyl-2-piperidinecarboxamide 2-piperidinecarboxamide, N-(2,6-dimethylphenyl)-1-methyl- Mepivacaine N-(2,6-Dimethylphenyl)-1-methylpiperidine-2-carboxamide |
| CAS | 22801-44-1 |
| EINECS | 1312995-182-4 |
| InChI | InChI=1/C15H22N2O/c1-11-7-6-8-12(2)14(11)16-15(18)13-9-4-5-10-17(13)3/h6-8,13H,4-5,9-10H2,1-3H3,(H,16,18) |
Mepivacaine - Physico-chemical Properties
| Molecular Formula | C15H22N2O |
| Molar Mass | 246.35 |
| Density | 1.077g/cm3 |
| Melting Point | 147-151°C |
| Boling Point | 383.1°C at 760 mmHg |
| Flash Point | 185.5°C |
| Solubility | Chloroform (Slightly), DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| Vapor Presure | 4.52E-06mmHg at 25°C |
| Appearance | Solid |
| Color | White to Off-White |
| pKa | pKa 7.73(H2O,t =25±0.2,I=0.01(NaCl)) (Uncertain) |
| Storage Condition | -20°C Freezer |
| Refractive Index | 1.567 |
