Name | Histametizine |
Synonyms | UCB 5062 UCB 5052 Vomissels Meclizine Vomisseis Meclozine mecilizine NSC 169189 Histametizine 1-(p-Chloro-a-phenylbenzyl)-4-(m-methylbenzyl)piperazine 1-((4-Chlorophenyl)phenylmethyl)-4-((3-methylphenyl)methyl)piperazine Piperazine, 1-(p-chloro-a-phenylbenzyl)-4-(m-methylbenzyl)- (6CI, 8CI) |
CAS | 569-65-3 |
EINECS | 209-323-3 |
InChI | InChI=1/C25H27ClN2/c1-20-6-5-7-21(18-20)19-27-14-16-28(17-15-27)25(22-8-3-2-4-9-22)23-10-12-24(26)13-11-23/h2-13,18,25H,14-17,19H2,1H3 |
Molecular Formula | C25H27ClN2 |
Molar Mass | 390.95 |
Density | 1.0318 (rough estimate) |
Melting Point | 153-157°C |
Boling Point | bp2 230° |
pKa | pKa 2.05(H2O,t =25,I=0.0051(NaCl)) (Uncertain) |
Storage Condition | 2-8°C |
Refractive Index | 1.5940 (estimate) |
Physical and Chemical Properties | Melting point 153-157°C water-soluble 1.5g/100 mL (25°C) |
Use | Used as a surfactant, printing and dyeing industry as penetrating agent |
Hazard Symbols | Xn - Harmful |