| Name | 2-Dicyclohexylphosphino-2'-methylbiphenyl |
| Synonyms | MePhos Me-phos 2-Dicyclohexylphosphino-2'-methylbiphenyl 2-(DICYCLOHEXYLPHOSPHINO)-2'-METHYLBIPHENYL 2-(Dicyclohexylphosphino)-2'-methylbiphenyl dicyclohexyl(2'-methylbiphenyl-2-yl)phosphane dicyclohexyl-[2-(2-methylphenyl)phenyl]phosphane 2-Dicyclohexylphosphino-2'-methyl-)-1,1'-biphenyl 2-Methyl-2μ-dicyclohexylphosphinobiphenyl, MebiphPCy2, MePhos |
| CAS | 251320-86-2 |
| EINECS | 607-557-4 |
| InChI | InChI=1/C25H33P/c1-20-12-8-9-17-23(20)24-18-10-11-19-25(24)26(21-13-4-2-5-14-21)22-15-6-3-7-16-22/h8-12,17-19,21-22H,2-7,13-16H2,1H3 |
| Molecular Formula | C25H33P |
| Molar Mass | 364.5 |
| Melting Point | 107-111 °C |
| Boling Point | 499.3±24.0 °C(Predicted) |
| Flash Point | 271.5°C |
| Water Solubility | insoluble |
| Solubility | soluble in Toluene |
| Vapor Presure | 1.3E-09mmHg at 25°C |
| Appearance | White crystal |
| Color | white |
| Storage Condition | Inert atmosphere,Room Temperature |
| Sensitive | Air Sensitive |
| MDL | MFCD03094577 |
| Physical and Chemical Properties | White crystals |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29310099 |
| Hazard Class | IRRITANT |
| Use | As a ligand, it is used in coupling reactions such as Buchwald, Suzuki, and the formation of α-aryl ketones. |