| Name | Melamine Phosphate |
| Synonyms | MP SLFR-7 Melamine Phosphate Melamine Polyphosphate Melamine phosphoric acid Phosphoric acid·melamine INTUMESCENT COMPOUND KE 8000 1,3,5-triazine-2,4,6-triamine phosphate 1,3,5-triazine-2,4,6-triamine polyphosphate 1,3,5-triazine-2,4,6-triamine monophosphate 1,3,5-Triazine-2,4,6-triamine polyphosphate 1,3,5-Triazine-2,4,6-triamine·phosphoric acid |
| CAS | 20208-95-1 |
| EINECS | 243-601-5 |
| InChI | InChI=1/C3H6N6.H3O4P/c4-1-7-2(5)9-3(6)8-1;1-5(2,3)4/h(H6,4,5,6,7,8,9);(H3,1,2,3,4)/p-3 |
| Molecular Formula | C3H9N6O4P |
| Molar Mass | 224.12 |
| Boling Point | 557.5°C at 760 mmHg |
| Flash Point | 325.3°C |
| Vapor Presure | 1.82E-12mmHg at 25°C |
| Appearance | Crystalline powder |
| Storage Condition | Room Temprature |
| Use | Environmental protection type non-halogen flame retardant |
| Reference Show more | 1. [IF=3.66] Liju Zheng et al."Inhibiting effect of inhibitors on ignition sensitivity of wood dust."J Loss Prevent Proc. 2021 May;70:104391 2. [IF=1.344] Ning Song et al."Investigation on suppression of melamine polyphosphate on acrylonitrile-butadiene-styrene dust explosion."Process Saf Prog. 2021 Dec;40(4):345-354 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | widely applicable to various synthetic resins, such as polyethylene, polypropylene, polystyrene resin, polycarbonate, polyurethane, EVA, thermoplastic elastomer, etc. |