| Name | Monomethyl dodecanedioate |
| Synonyms | Monomethyl dodecanedioate MONOMETHYL-DODECANEDIOATE 12-keto-12-methoxy-lauric acid MONOMETHYL DODECANE-1,12-DIOATE 12-methoxy-12-oxododecanoic acid 12-methoxy-12-oxo-dodecanoic acid Dodecanedioic Acid 1-Methyl Ester Dodecanedioic acid monomethyl ester DODECANEDIOIC ACID MONOMETHYL ESTER METHYL HYDROGEN DODECANE-1,12-DIOATE |
| CAS | 3903-40-0 |
| InChI | InChI=1/C13H24O4/c1-17-13(16)11-9-7-5-3-2-4-6-8-10-12(14)15/h2-11H2,1H3,(H,14,15) |
| Molecular Formula | C13H24O4 |
| Molar Mass | 244.33 |
| Density | 1.012±0.06 g/cm3(Predicted) |
| Melting Point | 51.5-52 °C |
| Boling Point | 170 °C(Press: 3 Torr) |
| Flash Point | 124.3°C |
| Solubility | DMSO (Slightly, Heated), Methanol (Slightly) |
| Vapor Presure | 5.28E-06mmHg at 25°C |
| Appearance | Solid |
| Color | White |
| pKa | 4.78±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.456 |
| Use | For the synthesis of spices, can also be used as a modifier of saturated polyester, heavy metal precipitation agent, special polyurethane raw materials |
| use | used for the synthesis of spices, etc., and can also be used as a modifier for saturated polyester, a precipitant for heavy metals, a raw material for special polyurethane, etc. |