| Name | N,N'-dimethyl-9,9'-biacridinium dinitrate |
| Synonyms | L-6868 LUCIGENIN NSC-151912 BIS(N-METHYLACRIDINIUM) NITRATE BIS(N-METHYLACRIDINIUM) DINITRATE 9,9'-BIS(N-METHYLACRIDINIUM NITRATE) N,N'-dimethyl-9,9'-biacridinium dinitrate lucigenin or N,N′-dimethyl-9,9′-biacridinium dinitrate 10,10'-Dimethyl-9,9'-biacridinium Dinitrate [for Chemiluminescence Research] |
| CAS | 2315-97-1 |
| EINECS | 219-023-4 |
| InChI | InChI=1/C28H22N2.2NO3/c1-29-23-15-7-3-11-19(23)27(20-12-4-8-16-24(20)29)28-21-13-5-9-17-25(21)30(2)26-18-10-6-14-22(26)28;2*2-1(3)4/h3-18H,1-2H3;;/q+2;2*-1 |
| Molecular Formula | C28H22N4O6 |
| Molar Mass | 510.5 |
| Melting Point | 250°C |
| Solubility | acetic acid: soluble10mg/mL |
| Appearance | powder |
| Color | Yellow powder with orange to brown cast |
| Maximum wavelength(λmax) | ['455nm'] |
| BRN | 3901768 |
| Storage Condition | Room Temprature |
| MDL | MFCD00011925 |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| UN IDs | 1479 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Hazard Class | 5.1 |
| Packing Group | III |
| 1mg | 5mg | 10mg | |
|---|---|---|---|
| 1 mM | 1.959 ml | 9.794 ml | 19.589 ml |
| 5 mM | 0.392 ml | 1.959 ml | 3.918 ml |
| 10 mM | 0.196 ml | 0.979 ml | 1.959 ml |
| 5 mM | 0.039 ml | 0.196 ml | 0.392 ml |
| biological field application | Chloride indicator; diagnosis of hemostatic disorders; detecting bacteria,nucleicacids,proteins,pathogens; identifying respiratory infections; generating and detecting reactive oxygen species; chemiluminescent indicator |
| Biological activity | Lucigenin (NSC-151912, L-6868) is a fluorescent probe that superoxide anion free radicals produced endogenously in cells The presence of anion radicals and chloride chloride emits blue-green fluorescence. |
| Target | Value |