| Name | 2,7-Dibromo-9,10-phenanthrenedione |
| Synonyms | JACS-84405-44-7 2,7-Dibromo-9,10-phenanthren 2,7-Dibromo-9,10-phenanthrenedione 2,7-Dibromophenanthrene-9,10-dione 2,7-DIBROMO-9,10-PHENANTHRENEDIONE 2,7-dibromo-phenanthrene-9,10-dione 2,7-Dibromo-9,10-phenanthrenequinone 9,10-phenanthrenedione, 2,7-dibromo- 2,7-dibroMo-9,10-dihydrophenanthrene-9,10-dione 2,7-DibroMo-9,10-Dihydrophenanthrene-9,10-Dione,2,7-Dibromo-9,10-Phenanthrenequinone |
| CAS | 84405-44-7 |
| EINECS | 805-819-4 |
| InChI | InChI=1/C14H6Br2O2/c15-7-1-3-9-10-4-2-8(16)6-12(10)14(18)13(17)11(9)5-7/h1-6H |
| Molecular Formula | C14H6Br2O2 |
| Molar Mass | 366 |
| Density | 1.911±0.06 g/cm3(Predicted) |
| Melting Point | 331°C(lit.) |
| Boling Point | 503.8±43.0 °C(Predicted) |
| Flash Point | 179.1°C |
| Vapor Presure | 2.81E-10mmHg at 25°C |
| Appearance | powder to crystal |
| Color | Light yellow to Yellow to Orange |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.7 |
| Overview | 2, 7-dibromo-phenanthroquinone is an important pharmaceutical intermediate, such as it can be used to prepare a soluble poly 5, 10-phenanthrene thiophene, Poly 5, 10-phenanthrene thiophene has a large conjugated co-planar structure, than polyfluorene, polysilylfluorene-based and polycarbazole-based polymers have narrow band gaps and meet the requirements of solar cell donor materials; Their structures contain thiophene and carboxyl groups, which will facilitate compatibility with fullerene (PCBM). The above two features make poly (5,10-phenanthrene thiophene) a new type of solar cell material. |
| preparation | the synthesis of 2, 7-dibromo-phenanthrene quinone was as follows: in a three-necked flask, phenanthrene quinone (6.24g,30mmol), concentrated sulfuric acid (50ml), NBS(11.2g,63mmol) was slowly added at 0 C, the reaction was 2 hours, the reaction solution was slowly poured into ice water, filtered, the resulting solid was recrystallized from dimethyl sulfoxide to give 5.6g of 2, 7-dibromo-phenanthroquinone as an orange solid in 50% yield. |