| Name | Isonipecotamide |
| Synonyms | Isonipecotamide Hexahydroisonicotimide LABOTEST-BB LT00848032 4-Piperidinecarboxamide 4-carbamoylpiperidinium HEXAHYDROISONICOTINAMIDE Hexahydroisonicotinamide piperidine-4-carboxamide |
| CAS | 39546-32-2 |
| EINECS | 254-501-6 |
| InChI | InChI=1/C6H12N2O/c7-6(9)5-1-3-8-4-2-5/h5,8H,1-4H2,(H2,7,9)/p+1 |
| Molecular Formula | C6H13N2O |
| Molar Mass | 129.18 |
| Density | 1.0754 (rough estimate) |
| Melting Point | 146-150℃ |
| Boling Point | 311.7°C at 760 mmHg |
| Flash Point | 142.3°C |
| Vapor Presure | 0.000553mmHg at 25°C |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| storage conditions | Keep in dark place,Inert atmosphere,Room temperature |
| acidity coefficient (pKa) | 16.48±0.20(Predicted) |
| morphology | Crystalline Powder |
| color | White to light yellow |
| water solubility | Soluble in water. |
| sensitivity | Hygroscopic |
| BRN | 112554 |
| InChIKey | DPBWFNDFMCCGGJ-UHFFFAOYSA-N |
| EPA chemical information | 4-Piperidinecarboxamide (39546-32-2) |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | Yes |
| customs code | 29339900 |