| Name | 4-methylvaleraldehyde |
| Synonyms | AI3-30050 isohexanal Isohexanal BRN 0506059 isocaproaldehyde 4-Methylpentanal Isocaproaldehyde 4-Methyl-1-pentanal Pentanal, 4-methyl- 4-Methylpentan-1-one 4-Methylvaleraldehyde 4-methylvaleraldehyde 4-Methyl valeraldehyde Valeraldehyde, 4-methyl- gamma-Methylvaleraldehyde 3-01-00-02836 (Beilstein Handbook Reference) |
| CAS | 1119-16-0 |
| EINECS | 214-273-0 |
| InChI | InChI=1/C6H12O/c1-6(2)4-3-5-7/h5-6H,3-4H2,1-2H3 |
| Molecular Formula | C6H12O |
| Molar Mass | 100.16 |
| Density | 0.8079 (estimate) |
| Melting Point | -72.5°C (estimate) |
| Boling Point | 128-135℃ |
| Flash Point | 17.8°C |
| Vapor Presure | 16.9mmHg at 25°C |
| Storage Condition | Room Temprature |
| Refractive Index | 1.4076 (estimate) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| category | flammable liquid |
| toxicity classification | poisoning |
| acute toxicity | reference value oral-rat LD50: 5660 mg/kg; Inhalation-rat LCL0: 16000 PPM/4 hours |
| stimulation data | skin-rabbit 10 mg/24 hours moderate |
| flammability hazard characteristics | flammability in case of open flame, high temperature and oxidant; Combustion produces stimulating smoke |
| storage and transportation characteristics | warehouse ventilation and low temperature drying; Store separately from oxidants and acids |
| fire extinguishing agent | dry powder, dry sand, carbon dioxide, foam, 1211 fire extinguishing agent |