| Name | 1,3-dihydro-3,3-bis(4-hydroxy-m-tolyl)-2H-indol-2-one |
| Synonyms | IBK Isatin-bis-cresol Isatin-bis-cresol 3,3-Bis(3-methyl-4-hydroxyphenyl)indoline-2-on 1,3-DIHYDRO-3,3-BIS(4-HYDROXY-3-METHYLPHENYL)-2H-I 1,3-dihydro-3,3-bis(4-hydroxy-m-tolyl)-2H-indol-2-one 1,3-Dihydro-3,3-bis(4-hydroxy-3-methylphenyl)-2H-indol-2-one 3,3-bis(4-hydroxy-3-methylphenyl)-1,3-dihydro-2H-indol-2-one 1,3-DIHYDRO-3,3-BIS(4-HYDROXY-3-METHYLPHENYL)-2H-INDOL-2-ONE 2H-Indol-2-one, 1,3-dihydro-3,3-bis(4-hydroxy-3-methylphenyl)- |
| CAS | 47465-97-4 |
| EINECS | 256-318-7 |
| InChI | InChI=1/C22H19NO3/c1-13-11-15(7-9-19(13)24)22(16-8-10-20(25)14(2)12-16)17-5-3-4-6-18(17)23-21(22)26/h3-12,24-25H,1-2H3,(H,23,26) |
| Molecular Formula | C22H19NO3 |
| Molar Mass | 345.39 |
| Density | 1.292±0.06 g/cm3(Predicted) |
| Melting Point | 250-251°C |
| Boling Point | 560.4±50.0 °C(Predicted) |
| Flash Point | 292.7°C |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Vapor Presure | 3.66E-13mmHg at 25°C |
| Appearance | Solid |
| Color | White to Off-White |
| pKa | 9.81±0.35(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.667 |
| Physical and Chemical Properties | Appearance: white crystalline powder Melting Point: greater than or equal to 251 ° C |
| Risk Codes | 20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | 36/37 - Wear suitable protective clothing and gloves. |
| UN IDs | 2811 |
| HS Code | 29349990 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |