| Name | Hydroxybenzoquinoline |
| Synonyms | 10-HBQ Hydroxybenzoquinoline HYDROXYBENZOQUINOLINE benzo[h]quinolin-10-ol 4-hydroxy-5-azaphenanthrene 10-HYDROXYBENZO[H]QUINOLINE 10-Hydroxybenzo[h]quinoline 10-Hydroxy-benzo[h]quinolin 10-HYDROXY-BENZO[H]QUINOLIN(10-HBQ) |
| CAS | 33155-90-7 |
| EINECS | 679-961-9 |
| InChI | InChI=1/C13H9NO/c15-11-5-1-3-9-6-7-10-4-2-8-14-13(10)12(9)11/h1-8,15H |
| Molecular Formula | C13H9NO |
| Molar Mass | 195.22 |
| Density | 1.307±0.06 g/cm3(Predicted) |
| Melting Point | 103-105°C |
| Boling Point | 420.6±18.0 °C(Predicted) |
| Flash Point | 208.184°C |
| Solubility | Soluble in acetone, chloroform and ethyl acetate. |
| Vapor Presure | 0mmHg at 25°C |
| Appearance | Solid |
| Color | Yellow |
| BRN | 141770 |
| pKa | 8.03±0.30(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.768 |
| MDL | MFCD00142350 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37 - Wear suitable gloves. |
| HS Code | 29334900 |
| application | 10-hydroxybenzo [H] quinoline is an organic synthesis intermediate and pharmaceutical intermediate, which can be used in laboratory research and development process and chemical production process. |