| Name | carbetapentane citrate |
| Synonyms | Atomin S Gai-Less 201-014-1 PENTOXYVERINE CITRATE PENTOXIVERINE CITRATE carbetapentane citrate CARBETAPENTANE CITRATE CARBETAPENTANE CITRATE SALT 2-[2-(Diethylamino)ethoxy]ethyl 1-phenylcyclopentanecarboxylate 2-{[2-(diethylamino)ethyl]oxy}ethyl 1-phenylcyclopentanecarboxylate 2-(2-(diethylamino)ethoxy)-ethano1-phenylcyclopentanecarboxylate(ester) cyclopentanecarboxylic acid, 1-phenyl-, 2-[2-(diethylamino)ethoxy]ethyl ester |
| CAS | 23142-01-0 |
| EINECS | 245-449-5 |
| InChI | InChI=1/C20H31NO3.2C6H8O7/c1-3-21(4-2)14-15-23-16-17-24-19(22)20(12-8-9-13-20)18-10-6-5-7-11-18;2*7-3(8)1-6(13,5(11)12)2-4(9)10/h5-7,10-11H,3-4,8-9,12-17H2,1-2H3;2*13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| Molecular Formula | C26H39NO10 |
| Molar Mass | 525.59 |
| Melting Point | 84-86?C |
| Boling Point | 435.5℃ at 760mmHg |
| Solubility | H2O: soluble |
| Appearance | White to off-white solid |
| Color | White to Off-White |
| Storage Condition | Sealed in dry,2-8°C |
| Use | For content determination |
| In vitro study | Pentoxyverine (Carbetapentane) Citrate has atropine-like and local anesthetic effects, and effectively suppresses acute cough caused by common upper respiratory tract infection. Pentoxyverine inhibits the cough reflex in the central nervous system, but the exact mechanism of action is not fully understood. The drug acts as a muscarinic receptor (M1 subtype) antagonist and sigma receptor (σ1 type) agonist. Its anticholinergic effect is theoretically able to relax the alveoli and reduce the production of sputum. |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | GY3500000 |
| biological activity | Pentoxyverine Citrate (Carbetapentane) is a antitussive (cough medicine), usually used to treat cough-related diseases, such as colds. |
| Target | Value |