| Name | o-Toluamide |
| Synonyms | 2-TOLUAMIDE o-Toluamide o-Tolylamide o-Toluic amide 2-Methylbenzamide 2-methyl-benzamid 2-METHYLBENZAMIDE o-Methylbenzamide Formyl-o-toluidine Benzamide, 2-methyl- (9CI) |
| CAS | 527-85-5 |
| EINECS | 208-427-6 |
| InChI | InChI=1/C8H9NO/c1-6-4-2-3-5-7(6)8(9)10/h2-5H,1H3,(H2,9,10) |
| Molecular Formula | C8H9NO |
| Molar Mass | 135.16 |
| Density | 1.086 |
| Melting Point | 141-142 °C (lit.) |
| Boling Point | 248.86°C (rough estimate) |
| Flash Point | 107.6°C |
| Solubility | alcohol: very soluble(lit.) |
| Vapor Presure | 0.0174mmHg at 25°C |
| Merck | 13,9606 |
| pKa | 16.01±0.50(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5589 (estimate) |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 22 - Harmful if swallowed |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |