| Name | Furaltadone |
| Synonyms | Furaltadone FURALTADONEBASE FURALTADONE VETRANAL FURALTADONE FREE BASE 5-MORPHOLINOMETHYL-3-(5-NITROFURFURYLIDENEAMINO)OXAZOLIDONE 5-MORPHOLINOMETHYL-3-(5-NITROFURFURYLIDENEAMINO)-2-OXAZOLIDINONE 5-(Morpholinomethyl)-3-(((5-nitrofuran-2-yl)methylene)amino)oxazolidin-2-one 2-Oxazolidinone, 5-(4-morpholinylmethyl)-3-(5-nitro-2-furanyl)methyleneamino- |
| CAS | 139-91-3 |
| EINECS | 205-384-5 |
| InChI | InChI=1/C13H16N4O6/c18-13-16(14-7-10-1-2-12(22-10)17(19)20)9-11(23-13)8-15-3-5-21-6-4-15/h1-2,7,11H,3-6,8-9H2/b14-7+ |
| Molecular Formula | C13H16N4O6 |
| Molar Mass | 324.29 |
| Density | 1.3046 (rough estimate) |
| Melting Point | 206°C (dec.) |
| Boling Point | 462.63°C (rough estimate) |
| Flash Point | 232.817°C |
| Solubility | Soluble in water |
| Vapor Presure | 0mmHg at 25°C |
| Appearance | Yellow crystalline solid |
| Color | Yellow |
| BRN | 8130725 |
| pKa | pKa 5.0 (Uncertain) |
| Storage Condition | Sealed in dry,2-8°C |
| Refractive Index | 1.6120 (estimate) |
| MDL | MFCD00057356 |
| Risk Codes | R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S3 - Keep in a cool place. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| UN IDs | 3249 |
| WGK Germany | 3 |
| RTECS | RQ3620000 |
| Hazard Class | 6.1(b) |
| Packing Group | III |
| traits | this product is yellow crystalline powder, odorless and bitter. |
| use | antibacterial drugs have significant curative effect on coccidia. Organic intermediates Antibacterial drugs have significant effects on coccidia. |
| biological activity | Furaltadone is a nitrofuran drug that can be used for the study of intestinal salmonella infection. Furaltadone has the effect of inhibiting staphylococci in vitro. |
| EPA chemical information | information provided by: ofmpub.epa.gov (external link) |