| Name | N-formyl-L-methionine |
| Synonyms | FMET FOR-MET-OH For-Met-OH For-L-Met-OH FOR-METHIONINE Formylmethionine n-formylmethionine FORMYL-L-METHIONINE N-FORMYL-L-METHIONINE N-formyl-L-methionine |
| CAS | 4289-98-9 |
| EINECS | 224-322-8 |
| InChI | InChI=1/C6H11NO3S/c1-11-3-2-5(6(9)10)7-4-8/h4-5H,2-3H2,1H3,(H,7,8)(H,9,10)/t5-/m0/s1 |
| Molecular Formula | C6H11NO3S |
| Molar Mass | 177.22 |
| Density | 1.242±0.06 g/cm3(Predicted) |
| Melting Point | 101 °C |
| Boling Point | 453.5±40.0 °C(Predicted) |
| Flash Point | 228.1°C |
| Vapor Presure | 1.74E-09mmHg at 25°C |
| Appearance | Solid |
| pKa | 3.32±0.10(Predicted) |
| Storage Condition | −20°C |
| Refractive Index | -10 ° (C=0.8, H2O) |
| MDL | MFCD00021033 |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29304000 |
| biological activity | N-Formyl-L-methionine (For-Met-OH) is an endogenous metabolite. |