| Name | 3,5-Dimethyl-1-phenyl-1H-pyrazole |
| Synonyms | AKOS B006749 Phenyldimethylpyrazole Dimethylphenylpyrazole Pyrazole, dimethylphenyl- 3,5-Dimethyl-N-phenylpyrazole 1,3-dimethyl-5-phenylpyrazole 3,5-DIMETHYL-1-PHENYLPYRAZOLE 3,5-Dimethyl-1-phenyl-1H-pyrazole 3,5-DIMETHYL-1-PHENYL-1H-PYRAZOLE 1-Phenyl-3,5-dimethyl-1H-pyrazole 1H-Pyrazole, 3,5-dimethyl-1-phenyl- Pyrazole, 3,5-dimethyl-1-phenyl- (6CI,7CI,8CI) |
| CAS | 1131-16-4 |
| EINECS | 214-462-8 |
| InChI | InChI=1/C11H12N2/c1-9-8-10(2)13(12-9)11-6-4-3-5-7-11/h3-8H,1-2H3 |
| Molecular Formula | C11H12N2 |
| Molar Mass | 172.23 |
| Density | 1,057 g/cm3 |
| Melting Point | 270-272℃ |
| Boling Point | 144-145°C 12mm |
| Flash Point | 144-145°C/12mm |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Vapor Presure | 0.0101mmHg at 25°C |
| Appearance | Oil |
| Color | Clear Light Yellow |
| BRN | 132902 |
| pKa | 1.78±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.57-1.573 |
| MDL | MFCD00020728 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| TSCA | Yes |
| HS Code | 29331990 |
| Hazard Class | IRRITANT |
| EPA chemical information | information provided by: ofmpub.epa.gov (external link) |