| Name | dibenzyl phthalate |
| Synonyms | Dibenzlphthalat BENZYL PHTHALATE DIBENZYL PHTHALATE dibenzyl phthalate Phthalic acid dibenzyl Phthalic acid dibenzyl ester dibenzyl benzene-1,3-dicarboxylate Dibenzyl phthalate Solution, 100ppm Dibenzyl ester of 1,2-benzenedicarboxylic acid 1,2-Benzenedicarboxylicacid,bis(phenylmethyl)ester 1,2-Benzenedicarboxylic acid, bis(phenylmethyl) ester Dibenzyl phthalate, (Phthalic acid dibenzyl ester) |
| CAS | 523-31-9 |
| EINECS | 208-344-5 |
| InChI | InChI=1/C22H18O4/c23-21(25-15-17-8-3-1-4-9-17)19-12-7-13-20(14-19)22(24)26-16-18-10-5-2-6-11-18/h1-14H,15-16H2 |
| Molecular Formula | C22H18O4 |
| Molar Mass | 346.38 |
| Density | 1.1637 (rough estimate) |
| Melting Point | 40-42°C |
| Boling Point | 276-278°C 15mm |
| Flash Point | 276-278°C/15mm |
| Water Solubility | Insoluble in water. |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Vapor Presure | 6.79E-10mmHg at 25°C |
| Appearance | Solid |
| Color | White to Off-White |
| BRN | 2338250 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.6000 (estimate) |
| MDL | MFCD00014437 |
| Physical and Chemical Properties | White crystals. The melting point of 44 deg C, boiling point of 277 deg C (2.0kPa). Very soluble in alcohol, ether and chloroform, water-soluble and petroleum ether. |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| use | plasticizer. |
| Production method | Esterification of phthalic anhydride by chlorination of phosphorus pentachloride and benzyl alcohol. |