| Name | 4'-Methoxyresveratrol |
| Synonyms | Desoxyrhapontigenin -5-(4-Methoxystyryl) 4'-Methoxy resveratol 4'-Methoxyresveratrol 4'-O-Methylresveratrol (E)-3,5-Dihydroxy-4'-methoxystilbene (E)-5-(4-Methoxystyryl)benzene-1,3-diol 5-[(E)-2-(4-Methoxyphenyl)vinyl]benzene-1,3-diol 5-[(E)-2-(4-methoxyphenyl)ethenyl]benzene-1,3-diol 1,3-benzenediol, 5-[(E)-2-(4-methoxyphenyl)ethenyl]- |
| CAS | 33626-08-3 |
| EINECS | 1312995-182-4 |
| InChI | InChI=1/C15H14O3/c1-18-15-6-4-11(5-7-15)2-3-12-8-13(16)10-14(17)9-12/h2-10,16-17H,1H3/b3-2+ |
| Molecular Formula | C15H14O3 |
| Molar Mass | 242.27 |
| Density | 1.252 |
| Melting Point | 158-166 °C |
| Boling Point | 446.5±14.0 °C(Predicted) |
| Flash Point | 223.8°C |
| Solubility | Soluble in methanol, ethanol, DMSO and other organic solvents |
| Vapor Presure | 1.38E-08mmHg at 25°C |
| Appearance | White powder |
| Color | White to Off-White |
| pKa | 9.19±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Stability | Light Sensitive |
| Refractive Index | 1.691 |
| MDL | MFCD12407152 |
| Physical and Chemical Properties | Yellow crystalline powder, soluble in methanol, ethanol, DMSO and other organic solvents, derived from rhubarb. |
| biological activity | 4 '-Methoxyresveratrol (4'-O-Methylresveratrol) is a polyphenolic compound derived from Diptera plants with anti-androgen, anti-fungal and anti-inflammatory activities. 4 '-Methoxyresveratrol can alleviate AGE-induced inflammation by inhibiting RAGE-mediated MAPK/NF-κB signaling pathway and activating NLRP3 inflammatory body. |
| Target | Value |