| Name | dl-O-tyrosine |
| Synonyms | D, L-O-TYR dl-O-tyrosine DL-O-TYROSINE DL-2-TYROSINE 2-hydroxyphenylalanine 3-(o-hydroxyphenyl)-alanindl DL-3-(2-HYDROXYPHENYL)ALANINE 3-(2-HYDROXYPHENYL)-DL-ALANINE 2-AMINO-3-(2-HYDROXYPHENYL)PROPIONIC ACID 3-(2-Hydroxyphenyl)-DL-alanine~H-DL-Phe(2-OH)-OH 2-amino-3-(1H-indol-3-yl)propan-1-ol ethanedioate (salt) |
| CAS | 2370-61-8 |
| EINECS | 219-134-8 |
| InChI | InChI=1/C11H14N2O.C2H2O4/c12-9(7-14)5-8-6-13-11-4-2-1-3-10(8)11;3-1(4)2(5)6/h1-4,6,9,13-14H,5,7,12H2;(H,3,4)(H,5,6) |
| Molecular Formula | C9H11NO3 |
| Molar Mass | 181.19 |
| Density | 1.333 |
| Melting Point | ~260°C (dec.) |
| Boling Point | 369℃ |
| Flash Point | 177℃ |
| Water Solubility | Soluble in water, and DMSO (Heated). |
| Solubility | Aqueous Acid (Sparingly, Sonicated), Aqueous Base (Slightly), DMSO (Slightly, He |
| Vapor Presure | 5.14E-18mmHg at 25°C |
| Appearance | Powder |
| Color | White to Light Grey |
| BRN | 2805789 |
| pKa | 2.31±0.10(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| MDL | MFCD00021725 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | YP2285000 |