| Name | 2,5-dihydroxyterephthalic acid |
| Synonyms | DHTA AI3-17877 2,5-Dihydroxyterepht 2,5-DIHYDROXYTEREPHTHALIC ACID 2,5-Dihydroxytelephthalic acid 2,5-dihydroxyterephthalic acid 2,5-dihydroxybenzene-1,4-dicarboxylic acid 2,5-Dihydroxy-1,4-benzenedicarboxylic acid 1,4-Benzenedicarboxylic acid, 2,5-dihydroxy- 2,5-Dihydroxyterephthalic acid,2,5-Dihydroxy-1,4-benzenedicarboxylic acid |
| CAS | 610-92-4 |
| EINECS | 210-239-4 |
| InChI | InChI=1/C8H6O6/c9-5-1-3(7(11)12)6(10)2-4(5)8(13)14/h1-2,9-10H,(H,11,12)(H,13,14) |
| InChIKey | OYFRNYNHAZOYNF-UHFFFAOYSA-N |
| Molecular Formula | C8H6O6 |
| Molar Mass | 198.13 |
| Density | 1.779±0.06 g/cm3(Predicted) |
| Melting Point | >300 °C (lit.) |
| Boling Point | 498.9±45.0 °C(Predicted) |
| Flash Point | 269.6°C |
| Solubility | Soluble in hot dimethylformamide. |
| Vapor Presure | 8.99E-11mmHg at 25°C |
| Appearance | Solid |
| Color | Dark gray to green |
| pKa | 2.17±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.717 |
| MDL | MFCD00132933 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| HS Code | 29181990 |
| Application | 2, 5-dihydroxyterephthalic acid is an organic synthesis intermediate and pharmaceutical intermediate, can be used in laboratory research and development process and chemical production process. |
| Application | 2, 5-dihydroxyterephthalic acid (DHTA) is a very important monomer for the synthesis of PIPD fiber, it plays an important role in organic synthesis. The yield and purity of DHTA directly affect the polymerization process of PIPD fiber. 2, 5-dihydroxyterephthalic acid is used in organic synthesis. |
| preparation | under alkaline conditions, 5-dihaloterephthalic acid is contacted with a source of copper and a ligand coordinated to copper, thereby producing 2, 5-dihydroxyterephthalic acid in high yield and purity. |