| Name | n-Decyldimethylchlorosilane |
| Synonyms | N-DECYLD chlorodecyldimethyl-silan Decylchlorodimethylsilane DECYLDIMETHYLCHLOROSILANE CHLORO(DECYL)DIMETHYLSILANE n-Decyldimethylchlorosilane Chloro(decyl)dimethylsilane 1-(CHLORODIMETHYLSILYL)DECANE (10-chlorodecyl)(dimethyl)silyl 10-chlorodecyl(dimethyl)silicon 1-(Chlorodimethylsilyl)decaneDecyldimethylchlorosilane |
| CAS | 38051-57-9 |
| EINECS | 253-761-8 |
| InChI | InChI=1/C12H26ClSi/c1-14(2)12-10-8-6-4-3-5-7-9-11-13/h3-12H2,1-2H3 |
| Molecular Formula | C12H27ClSi |
| Molar Mass | 234.88 |
| Density | 0.866 g/mL at 20 °C (lit.) |
| Boling Point | 98 °C/2 mmHg (lit.) |
| Flash Point | 137°C |
| Appearance | Liquid |
| Specific Gravity | 0.866 |
| Color | Colorless to Almost colorless |
| BRN | 2322585 |
| Storage Condition | 2-8℃ |
| Stability | Stable. Incompatible with strong oxidizing agents, moisture. |
| Sensitive | Moisture Sensitive |
| Refractive Index | n20/D 1.441 |
| MDL | MFCD00054168 |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | 34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S28 - After contact with skin, wash immediately with plenty of soap-suds. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 2987 8/PG 2 |
| WGK Germany | 1 |
| FLUKA BRAND F CODES | 10-21 |
| TSCA | Yes |
| HS Code | 29319090 |
| Hazard Class | 8 |
| Packing Group | III |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |